C20H25N3OS — CID 24559342
(E)-N-(1-adamantyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide (PubChem CID 24559342) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is (E)-N-(1-adamantyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(1-adamantyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 24559342 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (E)-N-(1-adamantyl)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
| SMILES | Cc1cn2c(/C=C/C(=O)NC34CC5CC(CC(C5)C3)C4)c(C)nc2s1 |
| InChI | InChI=1S/C20H25N3OS/c1-12-11-23-17(13(2)21-19(23)25-12)3-4-18(24)22-20-8-14-5-15(9-20)7-16(6-14)10-20/h3-4,11,14-16H,5-10H2,1-2H3,(H,22,24)/b4-3+ |
| InChIKey | VLYCFIBFJNGPFD-ONEGZZNKSA-N |
| XLogP | 4.11 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|