C17H17FN2O2 — CID 24560758
4-acetyl-N-cyclopropyl-N-[(2-fluorophenyl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 24560758) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 4-acetyl-N-cyclopropyl-N-[(2-fluorophenyl)methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-cyclopropyl-N-[(2-fluorophenyl)methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 24560758 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-acetyl-N-cyclopropyl-N-[(2-fluorophenyl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c[nH]c(C(=O)N(Cc2ccccc2F)C2CC2)c1 |
| InChI | InChI=1S/C17H17FN2O2/c1-11(21)13-8-16(19-9-13)17(22)20(14-6-7-14)10-12-4-2-3-5-15(12)18/h2-5,8-9,14,19H,6-7,10H2,1H3 |
| InChIKey | HADNYLYQOXIHLZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |