C22H26N6O5S — CID 24561483
4-[2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-5-nitrophenyl]sulfonylmorpholine (PubChem CID 24561483) has the molecular formula C22H26N6O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is 4-[2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-5-nitrophenyl]sulfonylmorpholine.
| Compound Name | 4-[2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-5-nitrophenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 24561483 |
| Molecular Formula | C22H26N6O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 4-[2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-5-nitrophenyl]sulfonylmorpholine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(Cc3cn4ccccc4n3)CC2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H26N6O5S/c29-28(30)19-4-5-20(21(15-19)34(31,32)27-11-13-33-14-12-27)25-9-7-24(8-10-25)16-18-17-26-6-2-1-3-22(26)23-18/h1-6,15,17H,7-14,16H2 |
| InChIKey | VJMUDMQPTMKDEY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|