C19H15ClN4O3S — CID 24561794
N-benzyl-5-[(Z)-1-chloro-2-(4-methyl-3-nitrophenyl)ethenyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 24561794) has the molecular formula C19H15ClN4O3S and a molecular weight of 414.87 g/mol. Its IUPAC name is N-benzyl-5-[(Z)-1-chloro-2-(4-methyl-3-nitrophenyl)ethenyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-benzyl-5-[(Z)-1-chloro-2-(4-methyl-3-nitrophenyl)ethenyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 24561794 |
| Molecular Formula | C19H15ClN4O3S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-benzyl-5-[(Z)-1-chloro-2-(4-methyl-3-nitrophenyl)ethenyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1ccc(/C=C(\Cl)c2nnc(C(=O)NCc3ccccc3)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15ClN4O3S/c1-12-7-8-14(10-16(12)24(26)27)9-15(20)18-22-23-19(28-18)17(25)21-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,21,25)/b15-9- |
| InChIKey | CHQKCAJNHSJMQS-DHDCSXOGSA-N |
| XLogP | 4.42 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|