C26H28N4O2S — CID 24563642
3'-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione (PubChem CID 24563642) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is 3'-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 24563642 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 3'-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCCCc3ccccc32)C(=O)N1CN1CCCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H28N4O2S/c31-24-26(15-7-5-10-18-9-1-2-11-19(18)26)28-25(32)30(24)17-29-16-8-6-13-21(29)23-27-20-12-3-4-14-22(20)33-23/h1-4,9,11-12,14,21H,5-8,10,13,15-17H2,(H,28,32) |
| InChIKey | AJTOOVKRIZUYEU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|