C21H20N2O5S — CID 24564749
ethyl 2-oxo-4-phenyl-6-[[(E)-3-thiophen-3-ylprop-2-enoyl]oxymethyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 24564749) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is ethyl 2-oxo-4-phenyl-6-[[(E)-3-thiophen-3-ylprop-2-enoyl]oxymethyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-oxo-4-phenyl-6-[[(E)-3-thiophen-3-ylprop-2-enoyl]oxymethyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 24564749 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | ethyl 2-oxo-4-phenyl-6-[[(E)-3-thiophen-3-ylprop-2-enoyl]oxymethyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COC(=O)/C=C/c2ccsc2)NC(=O)NC1c1ccccc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-2-27-20(25)18-16(12-28-17(24)9-8-14-10-11-29-13-14)22-21(26)23-19(18)15-6-4-3-5-7-15/h3-11,13,19H,2,12H2,1H3,(H2,22,23,26)/b9-8+ |
| InChIKey | XZHCSECEWIGEOV-CMDGGOBGSA-N |
| XLogP | 3.18 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|