C20H20N4O4S — CID 24565081
N-methyl-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-N-(4-nitrophenyl)acetamide (PubChem CID 24565081) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is N-methyl-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-N-(4-nitrophenyl)acetamide.
| Compound Name | N-methyl-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 24565081 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-methyl-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-N-(4-nitrophenyl)acetamide |
| SMILES | CC1CCc2c(sc3ncn(CC(=O)N(C)c4ccc([N+](=O)[O-])cc4)c(=O)c23)C1 |
| InChI | InChI=1S/C20H20N4O4S/c1-12-3-8-15-16(9-12)29-19-18(15)20(26)23(11-21-19)10-17(25)22(2)13-4-6-14(7-5-13)24(27)28/h4-7,11-12H,3,8-10H2,1-2H3 |
| InChIKey | CSCHMIWQNMOQMU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|