C22H26BrN3O2 — CID 24565676
1-[2-[(2-bromophenyl)methyl-methylamino]acetyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 24565676) has the molecular formula C22H26BrN3O2 and a molecular weight of 444.37 g/mol. Its IUPAC name is 1-[2-[(2-bromophenyl)methyl-methylamino]acetyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(2-bromophenyl)methyl-methylamino]acetyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24565676 |
| Molecular Formula | C22H26BrN3O2 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 1-[2-[(2-bromophenyl)methyl-methylamino]acetyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | CN(CC(=O)N1CCC(C(=O)Nc2ccccc2)CC1)Cc1ccccc1Br |
| InChI | InChI=1S/C22H26BrN3O2/c1-25(15-18-7-5-6-10-20(18)23)16-21(27)26-13-11-17(12-14-26)22(28)24-19-8-3-2-4-9-19/h2-10,17H,11-16H2,1H3,(H,24,28) |
| InChIKey | QBIGNHQSXLVYAE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |