C21H29N5O6S — CID 24568553
3-(N-[2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoethyl]-4-methoxyanilino)propanamide (PubChem CID 24568553) has the molecular formula C21H29N5O6S and a molecular weight of 479.56 g/mol. Its IUPAC name is 3-(N-[2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoethyl]-4-methoxyanilino)propanamide.
| Compound Name | 3-(N-[2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoethyl]-4-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 24568553 |
| Molecular Formula | C21H29N5O6S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 3-(N-[2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoethyl]-4-methoxyanilino)propanamide |
| SMILES | COc1ccc(N(CCC(N)=O)CC(=O)N2CCN(S(=O)(=O)c3c(C)noc3C)CC2)cc1 |
| InChI | InChI=1S/C21H29N5O6S/c1-15-21(16(2)32-23-15)33(29,30)26-12-10-24(11-13-26)20(28)14-25(9-8-19(22)27)17-4-6-18(31-3)7-5-17/h4-7H,8-14H2,1-3H3,(H2,22,27) |
| InChIKey | WIQGTEJLHBJGLR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|