About methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate
methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate (PubChem CID 24568561) has the molecular formula C16H17N3O5S2
and a molecular weight of 395.46 g/mol. Its IUPAC name is methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate |
| PubChem CID | 24568561 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CN1CCc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C16H17N3O5S2/c1-24-16(21)15-12(5-7-25-15)18-14(20)9-19-6-4-10-8-11(26(17,22)23)2-3-13(10)19/h2-3,5,7-8H,4,6,9H2,1H3,(H,18,20)(H2,17,22,23) |
| InChIKey | VKXHROYHOFXODW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate?
The IUPAC name of methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate (CID 24568561) is methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate is COC(=O)c1sccc1NC(=O)CN1CCc2cc(S(N)(=O)=O)ccc21.
What is the InChIKey of methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate?
The InChIKey is VKXHROYHOFXODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O5S2/c1-24-16(21)15-12(5-7-25-15)18-14(20)9-19-6-4-10-8-11(26(17,22)23)2-3-13(10)19/h2-3,5,7-8H,4,6,9H2,1H3,(H,18,20)(H2,17,22,23).
What are the key properties of methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate?
methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate has a molecular weight of 395.46 g/mol, XLogP of 1.18, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-(5-sulfamoyl-2,3-dihydroindol-1-yl)acetyl]amino]thiophene-2-carboxylate is sourced from PubChem (CID 24568561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).