C13H12FN3OS3 — CID 2456859
N-cyclopropyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 2456859) has the molecular formula C13H12FN3OS3 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-cyclopropyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopropyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2456859 |
| Molecular Formula | C13H12FN3OS3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | N-cyclopropyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nn(-c2ccc(F)cc2)c(=S)s1)NC1CC1 |
| InChI | InChI=1S/C13H12FN3OS3/c14-8-1-5-10(6-2-8)17-13(19)21-12(16-17)20-7-11(18)15-9-3-4-9/h1-2,5-6,9H,3-4,7H2,(H,15,18) |
| InChIKey | CJRSNIAXFJJKJS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|