C24H20N4O2S — CID 24571264
N-(phenylcarbamoyl)-2-(4-phenylphthalazin-1-yl)sulfanylpropanamide (PubChem CID 24571264) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is N-(phenylcarbamoyl)-2-(4-phenylphthalazin-1-yl)sulfanylpropanamide.
| Compound Name | N-(phenylcarbamoyl)-2-(4-phenylphthalazin-1-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 24571264 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(phenylcarbamoyl)-2-(4-phenylphthalazin-1-yl)sulfanylpropanamide |
| SMILES | CC(Sc1nnc(-c2ccccc2)c2ccccc12)C(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H20N4O2S/c1-16(22(29)26-24(30)25-18-12-6-3-7-13-18)31-23-20-15-9-8-14-19(20)21(27-28-23)17-10-4-2-5-11-17/h2-16H,1H3,(H2,25,26,29,30) |
| InChIKey | JQSHBBCZIACCHO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |