C21H21F2N3O4 — CID 24571527
N-(3,5-difluorophenyl)-2-[4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 24571527) has the molecular formula C21H21F2N3O4 and a molecular weight of 417.41 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-[4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3,5-difluorophenyl)-2-[4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 24571527 |
| Molecular Formula | C21H21F2N3O4 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-[4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc(CCC2(C)NC(=O)N(CC(=O)Nc3cc(F)cc(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H21F2N3O4/c1-21(8-7-13-3-5-17(30-2)6-4-13)19(28)26(20(29)25-21)12-18(27)24-16-10-14(22)9-15(23)11-16/h3-6,9-11H,7-8,12H2,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | HLAOPJLWBXPIJF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|