C13H20N4O3S2 — CID 24571951
N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 24571951) has the molecular formula C13H20N4O3S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 24571951 |
| Molecular Formula | C13H20N4O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1cnnc1SC(C)C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H20N4O3S2/c1-4-6-17-9-14-15-13(17)21-10(2)12(18)16(3)11-5-7-22(19,20)8-11/h4,9-11H,1,5-8H2,2-3H3 |
| InChIKey | RRUVCCHMCIZWMN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|