About 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide
2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 24572592) has the molecular formula C24H33N5O3
and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide |
| PubChem CID | 24572592 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | CCCCn1cnc2c1c(=O)n(CC(=O)N(C)Cc1ccccc1C)c(=O)n2CCCC |
| InChI | InChI=1S/C24H33N5O3/c1-5-7-13-27-17-25-22-21(27)23(31)29(24(32)28(22)14-8-6-2)16-20(30)26(4)15-19-12-10-9-11-18(19)3/h9-12,17H,5-8,13-16H2,1-4H3 |
| InChIKey | ADOPNHYJIDAOAD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide?
The IUPAC name of 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide (CID 24572592) is 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide.
What is the SMILES notation for 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide?
The canonical SMILES for 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide is CCCCn1cnc2c1c(=O)n(CC(=O)N(C)Cc1ccccc1C)c(=O)n2CCCC.
What is the InChIKey of 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide?
The InChIKey is ADOPNHYJIDAOAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33N5O3/c1-5-7-13-27-17-25-22-21(27)23(31)29(24(32)28(22)14-8-6-2)16-20(30)26(4)15-19-12-10-9-11-18(19)3/h9-12,17H,5-8,13-16H2,1-4H3.
What are the key properties of 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide?
2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide has a molecular weight of 439.56 g/mol, XLogP of 2.93, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-methyl-N-[(2-methylphenyl)methyl]acetamide is sourced from PubChem (CID 24572592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).