C21H25F2N5O3 — CID 24572611
2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(3,5-difluorophenyl)acetamide (PubChem CID 24572611) has the molecular formula C21H25F2N5O3 and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(3,5-difluorophenyl)acetamide.
| Compound Name | 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(3,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 24572611 |
| Molecular Formula | C21H25F2N5O3 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-(3,7-dibutyl-2,6-dioxopurin-1-yl)-N-(3,5-difluorophenyl)acetamide |
| SMILES | CCCCn1cnc2c1c(=O)n(CC(=O)Nc1cc(F)cc(F)c1)c(=O)n2CCCC |
| InChI | InChI=1S/C21H25F2N5O3/c1-3-5-7-26-13-24-19-18(26)20(30)28(21(31)27(19)8-6-4-2)12-17(29)25-16-10-14(22)9-15(23)11-16/h9-11,13H,3-8,12H2,1-2H3,(H,25,29) |
| InChIKey | OWXDPMICKCZSQE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |