C25H28N4O5 — CID 24572868
N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[2-(2-phenoxyethoxy)benzoyl]piperazin-1-yl]acetamide (PubChem CID 24572868) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[2-(2-phenoxyethoxy)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[2-(2-phenoxyethoxy)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24572868 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[2-(2-phenoxyethoxy)benzoyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cc(NC(=O)CN2CCN(C(=O)c3ccccc3OCCOc3ccccc3)CC2)no1 |
| InChI | InChI=1S/C25H28N4O5/c1-19-17-23(27-34-19)26-24(30)18-28-11-13-29(14-12-28)25(31)21-9-5-6-10-22(21)33-16-15-32-20-7-3-2-4-8-20/h2-10,17H,11-16,18H2,1H3,(H,26,27,30) |
| InChIKey | OQMYDUUTXGWOQQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|