C23H31NO4S — CID 24574639
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]acetamide (PubChem CID 24574639) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]acetamide |
|---|---|
| PubChem CID | 24574639 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CSCCCOc2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C23H31NO4S/c1-17-12-18(2)14-20(13-17)28-10-5-11-29-16-23(25)24-9-8-19-6-7-21(26-3)22(15-19)27-4/h6-7,12-15H,5,8-11,16H2,1-4H3,(H,24,25) |
| InChIKey | XGJKQXOSFBQSDH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|