C19H21ClN2O6S2 — CID 24575619
4-chloro-3-(2-methylmorpholine-4-carbonyl)-N-(4-methylsulfonylphenyl)benzenesulfonamide (PubChem CID 24575619) has the molecular formula C19H21ClN2O6S2 and a molecular weight of 472.97 g/mol. Its IUPAC name is 4-chloro-3-(2-methylmorpholine-4-carbonyl)-N-(4-methylsulfonylphenyl)benzenesulfonamide.
| Compound Name | 4-chloro-3-(2-methylmorpholine-4-carbonyl)-N-(4-methylsulfonylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24575619 |
| Molecular Formula | C19H21ClN2O6S2 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 4-chloro-3-(2-methylmorpholine-4-carbonyl)-N-(4-methylsulfonylphenyl)benzenesulfonamide |
| SMILES | CC1CN(C(=O)c2cc(S(=O)(=O)Nc3ccc(S(C)(=O)=O)cc3)ccc2Cl)CCO1 |
| InChI | InChI=1S/C19H21ClN2O6S2/c1-13-12-22(9-10-28-13)19(23)17-11-16(7-8-18(17)20)30(26,27)21-14-3-5-15(6-4-14)29(2,24)25/h3-8,11,13,21H,9-10,12H2,1-2H3 |
| InChIKey | APRLOZJXCUPPKG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |