C18H19F3N2O4S — CID 24575991
4-(propan-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 24575991) has the molecular formula C18H19F3N2O4S and a molecular weight of 416.42 g/mol. Its IUPAC name is 4-(propan-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 4-(propan-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 24575991 |
| Molecular Formula | C18H19F3N2O4S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4-(propan-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C(=O)NCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H19F3N2O4S/c1-12(2)23-28(25,26)16-9-5-14(6-10-16)17(24)22-11-13-3-7-15(8-4-13)27-18(19,20)21/h3-10,12,23H,11H2,1-2H3,(H,22,24) |
| InChIKey | WFQGOVNXROMXMD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |