C26H29NO2 — CID 2457700
N-(5-tert-butyl-2-methoxyphenyl)-3,3-diphenylpropanamide (PubChem CID 2457700) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-(5-tert-butyl-2-methoxyphenyl)-3,3-diphenylpropanamide.
| Compound Name | N-(5-tert-butyl-2-methoxyphenyl)-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 2457700 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-(5-tert-butyl-2-methoxyphenyl)-3,3-diphenylpropanamide |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-26(2,3)21-15-16-24(29-4)23(17-21)27-25(28)18-22(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-17,22H,18H2,1-4H3,(H,27,28) |
| InChIKey | NKXUXFLZXJSHMW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |