C17H18N4OS — CID 2457762
4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-phenylbutan-1-one (PubChem CID 2457762) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-phenylbutan-1-one.
| Compound Name | 4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 2457762 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-phenylbutan-1-one |
| SMILES | Cc1cc(C)n2nc(SCCCC(=O)c3ccccc3)nc2n1 |
| InChI | InChI=1S/C17H18N4OS/c1-12-11-13(2)21-16(18-12)19-17(20-21)23-10-6-9-15(22)14-7-4-3-5-8-14/h3-5,7-8,11H,6,9-10H2,1-2H3 |
| InChIKey | BFQOFJXZMDNCOZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|