About methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate
methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate (PubChem CID 24577749) has the molecular formula C18H23NO3S
and a molecular weight of 333.45 g/mol. Its IUPAC name is methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate.
Molecular Properties
| Compound Name | methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate |
| PubChem CID | 24577749 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSC(C)C(=O)/C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C18H23NO3S/c1-12(23-11-17(21)22-5)15(20)10-16-18(2,3)13-8-6-7-9-14(13)19(16)4/h6-10,12H,11H2,1-5H3/b16-10+ |
| InChIKey | DXQUDEXCPSGQFQ-MHWRWJLKSA-N |
| XLogP | 3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate?
The IUPAC name of methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate (CID 24577749) is methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate.
What is the SMILES notation for methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate?
The canonical SMILES for methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate is COC(=O)CSC(C)C(=O)/C=C1/N(C)c2ccccc2C1(C)C.
What is the InChIKey of methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate?
The InChIKey is DXQUDEXCPSGQFQ-MHWRWJLKSA-N. The full InChI is InChI=1S/C18H23NO3S/c1-12(23-11-17(21)22-5)15(20)10-16-18(2,3)13-8-6-7-9-14(13)19(16)4/h6-10,12H,11H2,1-5H3/b16-10+.
What are the key properties of methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate?
methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate has a molecular weight of 333.45 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylacetate is sourced from PubChem (CID 24577749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).