C17H18BrN3O5S — CID 24578003
1-[2-(4-bromophenyl)sulfonylethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 24578003) has the molecular formula C17H18BrN3O5S and a molecular weight of 456.32 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)sulfonylethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[2-(4-bromophenyl)sulfonylethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 24578003 |
| Molecular Formula | C17H18BrN3O5S |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 1-[2-(4-bromophenyl)sulfonylethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCS(=O)(=O)c2ccc(Br)cc2)c1=O |
| InChI | InChI=1S/C17H18BrN3O5S/c1-3-9-19-15(22)20(10-4-2)17(24)21(16(19)23)11-12-27(25,26)14-7-5-13(18)6-8-14/h3-8H,1-2,9-12H2 |
| InChIKey | IJDOATNIRPCALW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|