About N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide
N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 24578110) has the molecular formula C11H12N2O2S2
and a molecular weight of 268.36 g/mol. Its IUPAC name is N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| PubChem CID | 24578110 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CCN(c1nccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12N2O2S2/c1-2-13(11-12-8-9-16-11)17(14,15)10-6-4-3-5-7-10/h3-9H,2H2,1H3 |
| InChIKey | YTAVTSZECRROGB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The IUPAC name of N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide (CID 24578110) is N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide.
What is the SMILES notation for N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The canonical SMILES for N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide is CCN(c1nccs1)S(=O)(=O)c1ccccc1.
What is the InChIKey of N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The InChIKey is YTAVTSZECRROGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S2/c1-2-13(11-12-8-9-16-11)17(14,15)10-6-4-3-5-7-10/h3-9H,2H2,1H3.
What are the key properties of N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide?
N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide has a molecular weight of 268.36 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(1,3-thiazol-2-yl)benzenesulfonamide is sourced from PubChem (CID 24578110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).