About (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate
(5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 24578118) has the molecular formula C20H15FN2O2S
and a molecular weight of 366.42 g/mol. Its IUPAC name is (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 24578118 |
| Molecular Formula | C20H15FN2O2S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCc1ccc(-c2nc(C(=O)OCc3cc(C#N)ccc3F)cs2)cc1 |
| InChI | InChI=1S/C20H15FN2O2S/c1-2-13-3-6-15(7-4-13)19-23-18(12-26-19)20(24)25-11-16-9-14(10-22)5-8-17(16)21/h3-9,12H,2,11H2,1H3 |
| InChIKey | DKCKMWSWVJWZHK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate (CID 24578118) is (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate is CCc1ccc(-c2nc(C(=O)OCc3cc(C#N)ccc3F)cs2)cc1.
What is the InChIKey of (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate?
The InChIKey is DKCKMWSWVJWZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FN2O2S/c1-2-13-3-6-15(7-4-13)19-23-18(12-26-19)20(24)25-11-16-9-14(10-22)5-8-17(16)21/h3-9,12H,2,11H2,1H3.
What are the key properties of (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate?
(5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate has a molecular weight of 366.42 g/mol, XLogP of 4.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-2-fluorophenyl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 24578118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).