C26H23N5O5 — CID 24579203
[2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl] (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate (PubChem CID 24579203) has the molecular formula C26H23N5O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is [2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl] (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate.
| Compound Name | [2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl] (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 24579203 |
| Molecular Formula | C26H23N5O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | [2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl] (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
| SMILES | Cn1cc(/C=C/C(=O)OCC(=O)Nc2cc(-c3ccccc3)nn2-c2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C26H23N5O5/c1-29-16-19(25(34)30(2)26(29)35)13-14-24(33)36-17-23(32)27-22-15-21(18-9-5-3-6-10-18)28-31(22)20-11-7-4-8-12-20/h3-16H,17H2,1-2H3,(H,27,32)/b14-13+ |
| InChIKey | STXAGBHYKLTKDY-BUHFOSPRSA-N |
| XLogP | 2.13 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|