C20H20N4O5S — CID 24579214
[2-(4-methoxyanilino)-1,3-thiazol-4-yl]methyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate (PubChem CID 24579214) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-1,3-thiazol-4-yl]methyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate.
| Compound Name | [2-(4-methoxyanilino)-1,3-thiazol-4-yl]methyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 24579214 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [2-(4-methoxyanilino)-1,3-thiazol-4-yl]methyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
| SMILES | COc1ccc(Nc2nc(COC(=O)/C=C/c3cn(C)c(=O)n(C)c3=O)cs2)cc1 |
| InChI | InChI=1S/C20H20N4O5S/c1-23-10-13(18(26)24(2)20(23)27)4-9-17(25)29-11-15-12-30-19(22-15)21-14-5-7-16(28-3)8-6-14/h4-10,12H,11H2,1-3H3,(H,21,22)/b9-4+ |
| InChIKey | ZPIQCFRWEPHNNL-RUDMXATFSA-N |
| XLogP | 2.05 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|