About 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole
4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole (PubChem CID 2458027) has the molecular formula C10H7F3N4O2S
and a molecular weight of 304.25 g/mol. Its IUPAC name is 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole |
| PubChem CID | 2458027 |
| Molecular Formula | C10H7F3N4O2S |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole |
| SMILES | Cn1cnnc1Sc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7F3N4O2S/c1-16-5-14-15-9(16)20-8-3-2-6(10(11,12)13)4-7(8)17(18)19/h2-5H,1H3 |
| InChIKey | LWWOMGMMAPQDKO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole?
The IUPAC name of 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole (CID 2458027) is 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole.
What is the SMILES notation for 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole?
The canonical SMILES for 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole is Cn1cnnc1Sc1ccc(C(F)(F)F)cc1[N+](=O)[O-].
What is the InChIKey of 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole?
The InChIKey is LWWOMGMMAPQDKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N4O2S/c1-16-5-14-15-9(16)20-8-3-2-6(10(11,12)13)4-7(8)17(18)19/h2-5H,1H3.
What are the key properties of 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole?
4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole has a molecular weight of 304.25 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,2,4-triazole is sourced from PubChem (CID 2458027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).