About (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate
(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate (PubChem CID 24580990) has the molecular formula C17H15BrO4S
and a molecular weight of 395.27 g/mol. Its IUPAC name is (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate |
| PubChem CID | 24580990 |
| Molecular Formula | C17H15BrO4S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2ccc(Br)cc2)c2c1C(C)CC2=O |
| InChI | InChI=1S/C17H15BrO4S/c1-10-3-8-15(17-14(19)9-11(2)16(10)17)22-23(20,21)13-6-4-12(18)5-7-13/h3-8,11H,9H2,1-2H3 |
| InChIKey | AXYJKWWEGGMAPH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate?
The IUPAC name of (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate (CID 24580990) is (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate.
What is the SMILES notation for (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate?
The canonical SMILES for (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate is Cc1ccc(OS(=O)(=O)c2ccc(Br)cc2)c2c1C(C)CC2=O.
What is the InChIKey of (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate?
The InChIKey is AXYJKWWEGGMAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrO4S/c1-10-3-8-15(17-14(19)9-11(2)16(10)17)22-23(20,21)13-6-4-12(18)5-7-13/h3-8,11H,9H2,1-2H3.
What are the key properties of (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate?
(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate has a molecular weight of 395.27 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-bromobenzenesulfonate is sourced from PubChem (CID 24580990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).