C19H23F3N8OS — CID 24581261
N-(5-pentyl-1,3,4-thiadiazol-2-yl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide (PubChem CID 24581261) has the molecular formula C19H23F3N8OS and a molecular weight of 468.51 g/mol. Its IUPAC name is N-(5-pentyl-1,3,4-thiadiazol-2-yl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide.
| Compound Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24581261 |
| Molecular Formula | C19H23F3N8OS |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)C2CCN(c3ccc4nnc(C(F)(F)F)n4n3)CC2)s1 |
| InChI | InChI=1S/C19H23F3N8OS/c1-2-3-4-5-15-25-27-18(32-15)23-16(31)12-8-10-29(11-9-12)14-7-6-13-24-26-17(19(20,21)22)30(13)28-14/h6-7,12H,2-5,8-11H2,1H3,(H,23,27,31) |
| InChIKey | IDRCVJDUXLGEAQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 101.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|