C21H20N6O4S2 — CID 24581361
N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide (PubChem CID 24581361) has the molecular formula C21H20N6O4S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide.
| Compound Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 24581361 |
| Molecular Formula | C21H20N6O4S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(NC(=O)Cn2nnn(-c3cccs3)c2=O)cc1 |
| InChI | InChI=1S/C21H20N6O4S2/c1-25(14-16-6-3-2-4-7-16)33(30,31)18-11-9-17(10-12-18)22-19(28)15-26-21(29)27(24-23-26)20-8-5-13-32-20/h2-13H,14-15H2,1H3,(H,22,28) |
| InChIKey | HOAQOBOTASXPMV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |