C19H18INO3 — CID 24582153
2-[(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl)oxy]-N-(3-iodophenyl)acetamide (PubChem CID 24582153) has the molecular formula C19H18INO3 and a molecular weight of 435.26 g/mol. Its IUPAC name is 2-[(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl)oxy]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl)oxy]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 24582153 |
| Molecular Formula | C19H18INO3 |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 2-[(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl)oxy]-N-(3-iodophenyl)acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2cccc(I)c2)c2c1C(C)CC2=O |
| InChI | InChI=1S/C19H18INO3/c1-11-6-7-16(19-15(22)8-12(2)18(11)19)24-10-17(23)21-14-5-3-4-13(20)9-14/h3-7,9,12H,8,10H2,1-2H3,(H,21,23) |
| InChIKey | ZSMUMIZIEOYUQX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|