C22H18N6O — CID 24582888
(E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enenitrile (PubChem CID 24582888) has the molecular formula C22H18N6O and a molecular weight of 382.43 g/mol. Its IUPAC name is (E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 24582888 |
| Molecular Formula | C22H18N6O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enenitrile |
| SMILES | CCc1oc2ccccc2c1/C=C(\C#N)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C22H18N6O/c1-2-18-17(16-10-6-7-11-19(16)29-18)12-14(13-23)20-26-21(24)28-22(27-20)25-15-8-4-3-5-9-15/h3-12H,2H2,1H3,(H3,24,25,26,27,28)/b14-12+ |
| InChIKey | XCAURFTWEJHCCJ-WYMLVPIESA-N |
| XLogP | 4.57 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|