C25H26N2O3 — CID 24583465
propan-2-yl 4-[[2-(2-benzylanilino)-2-oxoethyl]amino]benzoate (PubChem CID 24583465) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is propan-2-yl 4-[[2-(2-benzylanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-(2-benzylanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 24583465 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | propan-2-yl 4-[[2-(2-benzylanilino)-2-oxoethyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NCC(=O)Nc2ccccc2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O3/c1-18(2)30-25(29)20-12-14-22(15-13-20)26-17-24(28)27-23-11-7-6-10-21(23)16-19-8-4-3-5-9-19/h3-15,18,26H,16-17H2,1-2H3,(H,27,28) |
| InChIKey | YMDDFJQXMFJYFL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |