C27H28N4O5 — CID 24583651
3-methoxy-N'-[2-[2-(phenoxymethyl)benzimidazol-1-yl]acetyl]-4-propoxybenzohydrazide (PubChem CID 24583651) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 3-methoxy-N'-[2-[2-(phenoxymethyl)benzimidazol-1-yl]acetyl]-4-propoxybenzohydrazide.
| Compound Name | 3-methoxy-N'-[2-[2-(phenoxymethyl)benzimidazol-1-yl]acetyl]-4-propoxybenzohydrazide |
|---|---|
| PubChem CID | 24583651 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3-methoxy-N'-[2-[2-(phenoxymethyl)benzimidazol-1-yl]acetyl]-4-propoxybenzohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)Cn2c(COc3ccccc3)nc3ccccc32)cc1OC |
| InChI | InChI=1S/C27H28N4O5/c1-3-15-35-23-14-13-19(16-24(23)34-2)27(33)30-29-26(32)17-31-22-12-8-7-11-21(22)28-25(31)18-36-20-9-5-4-6-10-20/h4-14,16H,3,15,17-18H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | XKJZFXCJQWSPNA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|