About 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide
1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide (PubChem CID 24584539) has the molecular formula C28H29N3O2
and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide |
| PubChem CID | 24584539 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide |
| SMILES | CC(CNC(=O)C1CCN(c2nc3ccccc3o2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29N3O2/c1-28(22-10-4-2-5-11-22,23-12-6-3-7-13-23)20-29-26(32)21-16-18-31(19-17-21)27-30-24-14-8-9-15-25(24)33-27/h2-15,21H,16-20H2,1H3,(H,29,32) |
| InChIKey | HPUMHOYBUSQKAL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide?
The IUPAC name of 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide (CID 24584539) is 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide.
What is the SMILES notation for 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide?
The canonical SMILES for 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide is CC(CNC(=O)C1CCN(c2nc3ccccc3o2)CC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide?
The InChIKey is HPUMHOYBUSQKAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29N3O2/c1-28(22-10-4-2-5-11-22,23-12-6-3-7-13-23)20-29-26(32)21-16-18-31(19-17-21)27-30-24-14-8-9-15-25(24)33-27/h2-15,21H,16-20H2,1H3,(H,29,32).
What are the key properties of 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide?
1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide has a molecular weight of 439.56 g/mol, XLogP of 5.17, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzoxazol-2-yl)-N-(2,2-diphenylpropyl)piperidine-4-carboxamide is sourced from PubChem (CID 24584539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).