C16H13N5O7 — CID 24584622
2-[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione (PubChem CID 24584622) has the molecular formula C16H13N5O7 and a molecular weight of 387.31 g/mol. Its IUPAC name is 2-[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 24584622 |
| Molecular Formula | C16H13N5O7 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione |
| SMILES | Cn1c(N)c(C(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H13N5O7/c1-18-12(17)11(14(24)19(2)16(18)26)9(22)6-20-13(23)7-4-3-5-8(21(27)28)10(7)15(20)25/h3-5H,6,17H2,1-2H3 |
| InChIKey | XBLXRTOPXODSRC-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|