C22H18ClN3O4 — CID 24586788
(4Z)-4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]methylidene]-2-(3,5-dimethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 24586788) has the molecular formula C22H18ClN3O4 and a molecular weight of 423.86 g/mol. Its IUPAC name is (4Z)-4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]methylidene]-2-(3,5-dimethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]methylidene]-2-(3,5-dimethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 24586788 |
| Molecular Formula | C22H18ClN3O4 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (4Z)-4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]methylidene]-2-(3,5-dimethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1cc(OC)cc(C2=N/C(=C\c3cnn(Cc4ccccc4Cl)c3)C(=O)O2)c1 |
| InChI | InChI=1S/C22H18ClN3O4/c1-28-17-8-16(9-18(10-17)29-2)21-25-20(22(27)30-21)7-14-11-24-26(12-14)13-15-5-3-4-6-19(15)23/h3-12H,13H2,1-2H3/b20-7- |
| InChIKey | JQOYGBWIKTUHRX-SCDVKCJHSA-N |
| XLogP | 3.95 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|