C13H8Cl3N3O3 — CID 24587413
1,3-dimethyl-2,4-dioxo-6-(2,4,5-trichlorophenoxy)pyrimidine-5-carbonitrile (PubChem CID 24587413) has the molecular formula C13H8Cl3N3O3 and a molecular weight of 360.58 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-6-(2,4,5-trichlorophenoxy)pyrimidine-5-carbonitrile.
| Compound Name | 1,3-dimethyl-2,4-dioxo-6-(2,4,5-trichlorophenoxy)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 24587413 |
| Molecular Formula | C13H8Cl3N3O3 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-6-(2,4,5-trichlorophenoxy)pyrimidine-5-carbonitrile |
| SMILES | Cn1c(Oc2cc(Cl)c(Cl)cc2Cl)c(C#N)c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H8Cl3N3O3/c1-18-11(20)6(5-17)12(19(2)13(18)21)22-10-4-8(15)7(14)3-9(10)16/h3-4H,1-2H3 |
| InChIKey | YUAKLTLTRUPHDP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|