C17H18N4OS — CID 24587655
2-[4-[(Z)-2-amino-1-cyanoprop-1-enyl]-1,3-thiazol-2-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 24587655) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-[4-[(Z)-2-amino-1-cyanoprop-1-enyl]-1,3-thiazol-2-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[4-[(Z)-2-amino-1-cyanoprop-1-enyl]-1,3-thiazol-2-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 24587655 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[4-[(Z)-2-amino-1-cyanoprop-1-enyl]-1,3-thiazol-2-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)Cc2nc(/C(C#N)=C(\C)N)cs2)cc1 |
| InChI | InChI=1S/C17H18N4OS/c1-3-12-4-6-13(7-5-12)20-16(22)8-17-21-15(10-23-17)14(9-18)11(2)19/h4-7,10H,3,8,19H2,1-2H3,(H,20,22)/b14-11+ |
| InChIKey | NJXVBFYYCYSRKZ-SDNWHVSQSA-N |
| XLogP | 3.10 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|