About 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid
4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid (PubChem CID 2458897) has the molecular formula C21H15N3O3S2
and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid |
| PubChem CID | 2458897 |
| Molecular Formula | C21H15N3O3S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(CSc1ncnc2scc(-c3ccccc3)c12)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H15N3O3S2/c25-17(24-15-8-6-14(7-9-15)21(26)27)11-29-20-18-16(13-4-2-1-3-5-13)10-28-19(18)22-12-23-20/h1-10,12H,11H2,(H,24,25)(H,26,27) |
| InChIKey | GMSGDTOFAVSQFR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid?
The IUPAC name of 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid (CID 2458897) is 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid.
What is the SMILES notation for 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid?
The canonical SMILES for 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid is O=C(CSc1ncnc2scc(-c3ccccc3)c12)Nc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid?
The InChIKey is GMSGDTOFAVSQFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O3S2/c25-17(24-15-8-6-14(7-9-15)21(26)27)11-29-20-18-16(13-4-2-1-3-5-13)10-28-19(18)22-12-23-20/h1-10,12H,11H2,(H,24,25)(H,26,27).
What are the key properties of 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid?
4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid has a molecular weight of 421.50 g/mol, XLogP of 4.79, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetyl]amino]benzoic acid is sourced from PubChem (CID 2458897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).