C19H20Cl2FN3O3S — CID 24589202
N-(4-chloro-2-fluorophenyl)-3-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]propanamide (PubChem CID 24589202) has the molecular formula C19H20Cl2FN3O3S and a molecular weight of 460.36 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-3-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]propanamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-3-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 24589202 |
| Molecular Formula | C19H20Cl2FN3O3S |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-3-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]propanamide |
| SMILES | O=C(CCN1CCN(S(=O)(=O)c2ccccc2Cl)CC1)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C19H20Cl2FN3O3S/c20-14-5-6-17(16(22)13-14)23-19(26)7-8-24-9-11-25(12-10-24)29(27,28)18-4-2-1-3-15(18)21/h1-6,13H,7-12H2,(H,23,26) |
| InChIKey | UZERZMMCTZFGKH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |