About 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol
4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol (PubChem CID 24590227) has the molecular formula C10H14N6O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol |
| PubChem CID | 24590227 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2ccc3nnnn3n2)CC1 |
| InChI | InChI=1S/C10H14N6O/c17-8-3-1-7(2-4-8)11-9-5-6-10-12-14-15-16(10)13-9/h5-8,17H,1-4H2,(H,11,13) |
| InChIKey | GAMPMXUFLRSFED-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol?
The IUPAC name of 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol (CID 24590227) is 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol.
What is the SMILES notation for 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol?
The canonical SMILES for 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol is OC1CCC(Nc2ccc3nnnn3n2)CC1.
What is the InChIKey of 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol?
The InChIKey is GAMPMXUFLRSFED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O/c17-8-3-1-7(2-4-8)11-9-5-6-10-12-14-15-16(10)13-9/h5-8,17H,1-4H2,(H,11,13).
What are the key properties of 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol?
4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol has a molecular weight of 234.26 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(tetrazolo[1,5-b]pyridazin-6-ylamino)cyclohexan-1-ol is sourced from PubChem (CID 24590227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).