About N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine
N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 24590304) has the molecular formula C11H16N6O
and a molecular weight of 248.29 g/mol. Its IUPAC name is N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 24590304 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | c1cc2nnnn2nc1NCCCOCC1CC1 |
| InChI | InChI=1S/C11H16N6O/c1(7-18-8-9-2-3-9)6-12-10-4-5-11-13-15-16-17(11)14-10/h4-5,9H,1-3,6-8H2,(H,12,14) |
| InChIKey | XKUBWDMXBSZNGL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine (CID 24590304) is N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine is c1cc2nnnn2nc1NCCCOCC1CC1.
What is the InChIKey of N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is XKUBWDMXBSZNGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6O/c1(7-18-8-9-2-3-9)6-12-10-4-5-11-13-15-16-17(11)14-10/h4-5,9H,1-3,6-8H2,(H,12,14).
What are the key properties of N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine?
N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 248.29 g/mol, XLogP of 0.75, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(cyclopropylmethoxy)propyl]tetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 24590304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).