C23H25N3O4S — CID 24590368
N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)quinoline-5-carboxamide (PubChem CID 24590368) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)quinoline-5-carboxamide.
| Compound Name | N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 24590368 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-(4-ethoxy-3-piperidin-1-ylsulfonylphenyl)quinoline-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cccc3ncccc23)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H25N3O4S/c1-2-30-21-12-11-17(16-22(21)31(28,29)26-14-4-3-5-15-26)25-23(27)19-8-6-10-20-18(19)9-7-13-24-20/h6-13,16H,2-5,14-15H2,1H3,(H,25,27) |
| InChIKey | WXVOJYRRFOANJB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |