C21H19N5O4S2 — CID 24591137
N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 24591137) has the molecular formula C21H19N5O4S2 and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 24591137 |
| Molecular Formula | C21H19N5O4S2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)c3ccccc3CN3C(=O)CNC3=O)n2)s1 |
| InChI | InChI=1S/C21H19N5O4S2/c1-12(27)22-8-14-6-7-17(32-14)16-11-31-20(24-16)25-19(29)15-5-3-2-4-13(15)10-26-18(28)9-23-21(26)30/h2-7,11H,8-10H2,1H3,(H,22,27)(H,23,30)(H,24,25,29) |
| InChIKey | PHQFZOIPFXBBIJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|