C20H14FN3O3S3 — CID 24591914
N-[4-[[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]methyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 24591914) has the molecular formula C20H14FN3O3S3 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[4-[[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]methyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | N-[4-[[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]methyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 24591914 |
| Molecular Formula | C20H14FN3O3S3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | N-[4-[[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]methyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CC(=O)N(c1nc(CN2C(=O)S/C(=C\c3cccs3)C2=O)cs1)c1ccccc1F |
| InChI | InChI=1S/C20H14FN3O3S3/c1-12(25)24(16-7-3-2-6-15(16)21)19-22-13(11-29-19)10-23-18(26)17(30-20(23)27)9-14-5-4-8-28-14/h2-9,11H,10H2,1H3/b17-9- |
| InChIKey | XQULDMXWRRGMKS-MFOYZWKCSA-N |
| XLogP | 5.26 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|