C12H12N3O2S2- — CID 2459268
2-[[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 2459268) has the molecular formula C12H12N3O2S2- and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-[[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | 2-[[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 2459268 |
| Molecular Formula | C12H12N3O2S2- |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-[[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCc1ccc(Nc2nnc(SCC(=O)[O-])s2)cc1 |
| InChI | InChI=1S/C12H13N3O2S2/c1-2-8-3-5-9(6-4-8)13-11-14-15-12(19-11)18-7-10(16)17/h3-6H,2,7H2,1H3,(H,13,14)(H,16,17)/p-1 |
| InChIKey | XAKCTSXHIQEGFJ-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |