C26H26N2O6 — CID 24593018
[2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 24593018) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is [2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 24593018 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1C(=O)COC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H26N2O6/c1-25(2)13-18(29)14-26(3,4)28(25)21(30)15-34-24(33)16-9-11-17(12-10-16)27-22(31)19-7-5-6-8-20(19)23(27)32/h5-12H,13-15H2,1-4H3 |
| InChIKey | WSCJMISTHQDDDM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|